C24H29NO2S — CID 11133030
N-benzyl-4-methyl-N-[(5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]benzenesulfonamide (PubChem CID 11133030) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-[(5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-[(5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11133030 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-benzyl-4-methyl-N-[(5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]benzenesulfonamide |
| SMILES | C=C(C)[C@H]1CC=C(C)C(N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H29NO2S/c1-18(2)22-13-12-20(4)24(16-22)25(17-21-8-6-5-7-9-21)28(26,27)23-14-10-19(3)11-15-23/h5-12,14-15,22,24H,1,13,16-17H2,2-4H3/t22-,24?/m0/s1 |
| InChIKey | URBLEYKIXUNTDQ-OWJIYDKWSA-N |
| XLogP | 5.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|