C24H23NO3S — CID 11711172
N-benzyl-4-methyl-N-(4-methylidene-1H-isochromen-3-yl)benzenesulfonamide (PubChem CID 11711172) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-(4-methylidene-1H-isochromen-3-yl)benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-(4-methylidene-1H-isochromen-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11711172 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-benzyl-4-methyl-N-(4-methylidene-1H-isochromen-3-yl)benzenesulfonamide |
| SMILES | C=C1c2ccccc2COC1N(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23NO3S/c1-18-12-14-22(15-13-18)29(26,27)25(16-20-8-4-3-5-9-20)24-19(2)23-11-7-6-10-21(23)17-28-24/h3-15,24H,2,16-17H2,1H3 |
| InChIKey | CAKPDULTGRSOEJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |