C24H36O8 — CID 11134179
(1S,5S,6R,7S,11R,12R,16R,19S)-7,19-dihydroxy-7-(hydroxymethyl)-11,14,14,18,21,21-hexamethyl-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one (PubChem CID 11134179) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is (1S,5S,6R,7S,11R,12R,16R,19S)-7,19-dihydroxy-7-(hydroxymethyl)-11,14,14,18,21,21-hexamethyl-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one.
| Compound Name | (1S,5S,6R,7S,11R,12R,16R,19S)-7,19-dihydroxy-7-(hydroxymethyl)-11,14,14,18,21,21-hexamethyl-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
|---|---|
| PubChem CID | 11134179 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1S,5S,6R,7S,11R,12R,16R,19S)-7,19-dihydroxy-7-(hydroxymethyl)-11,14,14,18,21,21-hexamethyl-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
| SMILES | CC1=C2[C@H]3OC(C)(C)O[C@@H]3[C@]3(C)CCC[C@@](O)(CO)[C@H]3[C@@H]3OC(=O)O[C@@]3(C[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C24H36O8/c1-12-13(26)10-24-18(29-19(27)32-24)16-22(6,8-7-9-23(16,28)11-25)17-15(14(12)20(24,2)3)30-21(4,5)31-17/h13,15-18,25-26,28H,7-11H2,1-6H3/t13-,15+,16-,17-,18-,22+,23+,24+/m0/s1 |
| InChIKey | SIRQAZPDZTZRJU-VZNKVILSSA-N |
| XLogP | 2.43 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|