C25H27NO5S — CID 11134188
benzyl (4aS,8aR)-6-methyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 11134188) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is benzyl (4aS,8aR)-6-methyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aS,8aR)-6-methyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 11134188 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | benzyl (4aS,8aR)-6-methyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | CC1=CC[C@]2(C(=O)OCc3ccccc3)C(=O)N(S(=O)(=O)c3ccc(C)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C25H27NO5S/c1-18-8-10-22(11-9-18)32(29,30)26-15-13-21-16-19(2)12-14-25(21,23(26)27)24(28)31-17-20-6-4-3-5-7-20/h3-12,21H,13-17H2,1-2H3/t21-,25-/m1/s1 |
| InChIKey | GPPMBDTWYFWGTR-PXDATVDWSA-N |
| XLogP | 4.00 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|