C37H30O3 — CID 11135120
(1S,5R,7R)-5-methyl-1',2',3',4'-tetraphenylspiro[9,10-dioxatricyclo[5.2.1.01,5]decane-8,5'-cyclopenta-1,3-diene]-6-one (PubChem CID 11135120) has the molecular formula C37H30O3 and a molecular weight of 522.64 g/mol. Its IUPAC name is (1S,5R,7R)-5-methyl-1',2',3',4'-tetraphenylspiro[9,10-dioxatricyclo[5.2.1.01,5]decane-8,5'-cyclopenta-1,3-diene]-6-one.
| Compound Name | (1S,5R,7R)-5-methyl-1',2',3',4'-tetraphenylspiro[9,10-dioxatricyclo[5.2.1.01,5]decane-8,5'-cyclopenta-1,3-diene]-6-one |
|---|---|
| PubChem CID | 11135120 |
| Molecular Formula | C37H30O3 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (1S,5R,7R)-5-methyl-1',2',3',4'-tetraphenylspiro[9,10-dioxatricyclo[5.2.1.01,5]decane-8,5'-cyclopenta-1,3-diene]-6-one |
| SMILES | C[C@]12CCC[C@@]13O[C@@H](C2=O)C1(O3)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C37H30O3/c1-35-23-14-24-36(35)39-34(33(35)38)37(40-36)31(27-19-10-4-11-20-27)29(25-15-6-2-7-16-25)30(26-17-8-3-9-18-26)32(37)28-21-12-5-13-22-28/h2-13,15-22,34H,14,23-24H2,1H3/t34-,35+,36-/m0/s1 |
| InChIKey | UYVIHJGXBJAPPK-PDHQKIGBSA-N |
| XLogP | 7.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|