C38H32O3 — CID 11049786
(1S,6R,8R)-6-methyl-1',2',3',4'-tetraphenylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,5'-cyclopenta-1,3-diene]-7-one (PubChem CID 11049786) has the molecular formula C38H32O3 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1S,6R,8R)-6-methyl-1',2',3',4'-tetraphenylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,5'-cyclopenta-1,3-diene]-7-one.
| Compound Name | (1S,6R,8R)-6-methyl-1',2',3',4'-tetraphenylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,5'-cyclopenta-1,3-diene]-7-one |
|---|---|
| PubChem CID | 11049786 |
| Molecular Formula | C38H32O3 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (1S,6R,8R)-6-methyl-1',2',3',4'-tetraphenylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,5'-cyclopenta-1,3-diene]-7-one |
| SMILES | C[C@]12CCCC[C@@]13O[C@@H](C2=O)C1(O3)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C38H32O3/c1-36-24-14-15-25-37(36)40-35(34(36)39)38(41-37)32(28-20-10-4-11-21-28)30(26-16-6-2-7-17-26)31(27-18-8-3-9-19-27)33(38)29-22-12-5-13-23-29/h2-13,16-23,35H,14-15,24-25H2,1H3/t35-,36+,37-/m0/s1 |
| InChIKey | GPCOKKSGQJRPQM-QOEXFKEZSA-N |
| XLogP | 8.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|