C26H26O3 — CID 11749506
(1'S,3E,6'R,8'R)-3-benzylidene-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one (PubChem CID 11749506) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1'S,3E,6'R,8'R)-3-benzylidene-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one.
| Compound Name | (1'S,3E,6'R,8'R)-3-benzylidene-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one |
|---|---|
| PubChem CID | 11749506 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (1'S,3E,6'R,8'R)-3-benzylidene-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one |
| SMILES | C[C@]12CCCC[C@@]13O[C@@H](C2=O)C1(O3)/C(=C/c2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C26H26O3/c1-24-15-7-8-16-25(24)28-23(22(24)27)26(29-25)20(17-18-9-3-2-4-10-18)14-13-19-11-5-6-12-21(19)26/h2-6,9-12,17,23H,7-8,13-16H2,1H3/b20-17+/t23-,24+,25-,26?/m0/s1 |
| InChIKey | KNFOCECFLPMSOQ-XXUXUWKISA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |