C36H30O3 — CID 10918251
(1S,4R)-1,6,6-trimethyl-1',2',3',4'-tetraphenylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,5'-cyclopenta-1,3-diene]-5-one (PubChem CID 10918251) has the molecular formula C36H30O3 and a molecular weight of 510.63 g/mol. Its IUPAC name is (1S,4R)-1,6,6-trimethyl-1',2',3',4'-tetraphenylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,5'-cyclopenta-1,3-diene]-5-one.
| Compound Name | (1S,4R)-1,6,6-trimethyl-1',2',3',4'-tetraphenylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,5'-cyclopenta-1,3-diene]-5-one |
|---|---|
| PubChem CID | 10918251 |
| Molecular Formula | C36H30O3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (1S,4R)-1,6,6-trimethyl-1',2',3',4'-tetraphenylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,5'-cyclopenta-1,3-diene]-5-one |
| SMILES | CC1(C)C(=O)[C@@H]2O[C@@]1(C)OC21C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C36H30O3/c1-34(2)32(37)33-36(39-35(34,3)38-33)30(26-20-12-6-13-21-26)28(24-16-8-4-9-17-24)29(25-18-10-5-11-19-25)31(36)27-22-14-7-15-23-27/h4-23,33H,1-3H3/t33-,35-/m0/s1 |
| InChIKey | SFWKENKQBCDJBO-LRHLLKFHSA-N |
| XLogP | 7.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|