C27H26Cl2O3 — CID 101174002
(1S,2'E,4R,6'E)-2',6'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclohexane]-5-one (PubChem CID 101174002) has the molecular formula C27H26Cl2O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is (1S,2'E,4R,6'E)-2',6'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclohexane]-5-one.
| Compound Name | (1S,2'E,4R,6'E)-2',6'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 101174002 |
| Molecular Formula | C27H26Cl2O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (1S,2'E,4R,6'E)-2',6'-bis[(4-chlorophenyl)methylidene]-1,6,6-trimethylspiro[2,7-dioxabicyclo[2.2.1]heptane-3,1'-cyclohexane]-5-one |
| SMILES | CC1(C)C(=O)[C@@H]2O[C@@]1(C)OC21/C(=C/c2ccc(Cl)cc2)CCC/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26Cl2O3/c1-25(2)23(30)24-27(32-26(25,3)31-24)19(15-17-7-11-21(28)12-8-17)5-4-6-20(27)16-18-9-13-22(29)14-10-18/h7-16,24H,4-6H2,1-3H3/b19-15+,20-16+/t24-,26-/m0/s1 |
| InChIKey | SMROZZBJOMJEOF-POJDRYQKSA-N |
| XLogP | 7.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |