C26H25ClO3 — CID 11235505
(1'S,3E,6'R,8'R)-3-[(4-chlorophenyl)methylidene]-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one (PubChem CID 11235505) has the molecular formula C26H25ClO3 and a molecular weight of 420.94 g/mol. Its IUPAC name is (1'S,3E,6'R,8'R)-3-[(4-chlorophenyl)methylidene]-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one.
| Compound Name | (1'S,3E,6'R,8'R)-3-[(4-chlorophenyl)methylidene]-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one |
|---|---|
| PubChem CID | 11235505 |
| Molecular Formula | C26H25ClO3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (1'S,3E,6'R,8'R)-3-[(4-chlorophenyl)methylidene]-6'-methylspiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-7'-one |
| SMILES | C[C@]12CCCC[C@@]13O[C@@H](C2=O)C1(O3)/C(=C/c2ccc(Cl)cc2)CCc2ccccc21 |
| InChI | InChI=1S/C26H25ClO3/c1-24-14-4-5-15-25(24)29-23(22(24)28)26(30-25)19(16-17-8-12-20(27)13-9-17)11-10-18-6-2-3-7-21(18)26/h2-3,6-9,12-13,16,23H,4-5,10-11,14-15H2,1H3/b19-16+/t23-,24+,25-,26?/m0/s1 |
| InChIKey | DVQJHXWMFQRCRP-PEVXLOPGSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |