C31H48NO3Si+ — CID 11135368
[(1R,2S)-2-(2-propan-2-ylphenyl)cyclohexyl] 4-methoxy-3-tri(propan-2-yl)silylpyridin-1-ium-1-carboxylate (PubChem CID 11135368) has the molecular formula C31H48NO3Si+ and a molecular weight of 510.82 g/mol. Its IUPAC name is [(1R,2S)-2-(2-propan-2-ylphenyl)cyclohexyl] 4-methoxy-3-tri(propan-2-yl)silylpyridin-1-ium-1-carboxylate.
| Compound Name | [(1R,2S)-2-(2-propan-2-ylphenyl)cyclohexyl] 4-methoxy-3-tri(propan-2-yl)silylpyridin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 11135368 |
| Molecular Formula | C31H48NO3Si+ |
| Molecular Weight | 510.82 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | [(1R,2S)-2-(2-propan-2-ylphenyl)cyclohexyl] 4-methoxy-3-tri(propan-2-yl)silylpyridin-1-ium-1-carboxylate |
| SMILES | COc1cc[n+](C(=O)O[C@@H]2CCCC[C@H]2c2ccccc2C(C)C)cc1[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H48NO3Si/c1-21(2)25-14-10-11-15-26(25)27-16-12-13-17-28(27)35-31(33)32-19-18-29(34-9)30(20-32)36(22(3)4,23(5)6)24(7)8/h10-11,14-15,18-24,27-28H,12-13,16-17H2,1-9H3/q+1/t27-,28+/m0/s1 |
| InChIKey | HQBDZVWWJRIFDE-WUFINQPMSA-N |
| XLogP | 7.70 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.82 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|