C18H35IN6O — CID 111383300
N-tert-butyl-2-[[[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111383300) has the molecular formula C18H35IN6O and a molecular weight of 478.42 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111383300 |
| Molecular Formula | C18H35IN6O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-tert-butyl-2-[[[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(C)Cn1nc(C)cc1C.I |
| InChI | InChI=1S/C18H34N6O.HI/c1-8-19-17(21-11-16(25)22-18(5,6)7)20-10-13(2)12-24-15(4)9-14(3)23-24;/h9,13H,8,10-12H2,1-7H3,(H,22,25)(H2,19,20,21);1H |
| InChIKey | DPXCHJKORQBSFU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|