C16H26O3 — CID 11140077
(E)-5,5-dimethoxy-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-one (PubChem CID 11140077) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (E)-5,5-dimethoxy-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-one.
| Compound Name | (E)-5,5-dimethoxy-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 11140077 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (E)-5,5-dimethoxy-1-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-one |
| SMILES | COC(CC(=O)/C=C/C1=C(C)CCCC1(C)C)OC |
| InChI | InChI=1S/C16H26O3/c1-12-7-6-10-16(2,3)14(12)9-8-13(17)11-15(18-4)19-5/h8-9,15H,6-7,10-11H2,1-5H3/b9-8+ |
| InChIKey | MNZGLSRRCQJUMY-CMDGGOBGSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|