C17H26O3 — CID 23258837
(3E,5E)-1,1-dimethoxy-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-2-one (PubChem CID 23258837) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3E,5E)-1,1-dimethoxy-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-1,1-dimethoxy-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 23258837 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3E,5E)-1,1-dimethoxy-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-2-one |
| SMILES | COC(OC)C(=O)/C=C/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C17H26O3/c1-13-9-8-12-17(2,3)14(13)10-6-7-11-15(18)16(19-4)20-5/h6-7,10-11,16H,8-9,12H2,1-5H3/b10-6+,11-7+ |
| InChIKey | CFUCJDMPUIODPK-JMQWPVDRSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|