C21H32O3 — CID 14214172
(4E,6E,8E)-1,1-dimethoxy-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trien-3-one (PubChem CID 14214172) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (4E,6E,8E)-1,1-dimethoxy-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trien-3-one.
| Compound Name | (4E,6E,8E)-1,1-dimethoxy-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trien-3-one |
|---|---|
| PubChem CID | 14214172 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4E,6E,8E)-1,1-dimethoxy-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trien-3-one |
| SMILES | COC(CC(=O)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OC |
| InChI | InChI=1S/C21H32O3/c1-16(9-7-11-18(22)15-20(23-5)24-6)12-13-19-17(2)10-8-14-21(19,3)4/h7,9,11-13,20H,8,10,14-15H2,1-6H3/b11-7+,13-12+,16-9+ |
| InChIKey | YGMBUSCBEQHGSR-HXAUSYJYSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|