C17H22F2N2O3 — CID 111424952
1-(dicyclopropylmethyl)-3-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]urea (PubChem CID 111424952) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-(dicyclopropylmethyl)-3-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]urea.
| Compound Name | 1-(dicyclopropylmethyl)-3-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 111424952 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(dicyclopropylmethyl)-3-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccc(OC(F)F)cc1)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H22F2N2O3/c18-16(19)24-13-7-5-10(6-8-13)14(22)9-20-17(23)21-15(11-1-2-11)12-3-4-12/h5-8,11-12,14-16,22H,1-4,9H2,(H2,20,21,23) |
| InChIKey | IMKDFZFUALJKES-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |