C17H21BrO5 — CID 11143505
(3aR,5R,6R,6aR)-6-[(2-bromo-5-methoxyphenyl)methoxy]-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11143505) has the molecular formula C17H21BrO5 and a molecular weight of 385.25 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-6-[(2-bromo-5-methoxyphenyl)methoxy]-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R,6aR)-6-[(2-bromo-5-methoxyphenyl)methoxy]-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11143505 |
| Molecular Formula | C17H21BrO5 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (3aR,5R,6R,6aR)-6-[(2-bromo-5-methoxyphenyl)methoxy]-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C=C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OCc1cc(OC)ccc1Br |
| InChI | InChI=1S/C17H21BrO5/c1-5-13-14(15-16(21-13)23-17(2,3)22-15)20-9-10-8-11(19-4)6-7-12(10)18/h5-8,13-16H,1,9H2,2-4H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | DZQCDICMCYHUAA-KLHDSHLOSA-N |
| XLogP | 3.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|