C8H18N2O2S — CID 111435312
1-(1-hydroxypropan-2-yl)-3-(1-methylsulfanylpropan-2-yl)urea (PubChem CID 111435312) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-3-(1-methylsulfanylpropan-2-yl)urea.
| Compound Name | 1-(1-hydroxypropan-2-yl)-3-(1-methylsulfanylpropan-2-yl)urea |
|---|---|
| PubChem CID | 111435312 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-3-(1-methylsulfanylpropan-2-yl)urea |
| SMILES | CSCC(C)NC(=O)NC(C)CO |
| InChI | InChI=1S/C8H18N2O2S/c1-6(4-11)9-8(12)10-7(2)5-13-3/h6-7,11H,4-5H2,1-3H3,(H2,9,10,12) |
| InChIKey | WAUPXIGKBHVKLF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |