C11H22N2OS — CID 124886093
1-[(3R)-hex-5-en-3-yl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea (PubChem CID 124886093) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 1-[(3R)-hex-5-en-3-yl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea.
| Compound Name | 1-[(3R)-hex-5-en-3-yl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea |
|---|---|
| PubChem CID | 124886093 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-[(3R)-hex-5-en-3-yl]-3-[(2R)-1-methylsulfanylpropan-2-yl]urea |
| SMILES | C=CC[C@@H](CC)NC(=O)N[C@H](C)CSC |
| InChI | InChI=1S/C11H22N2OS/c1-5-7-10(6-2)13-11(14)12-9(3)8-15-4/h5,9-10H,1,6-8H2,2-4H3,(H2,12,13,14)/t9-,10-/m1/s1 |
| InChIKey | NEWUGBPKFSHGEK-NXEZZACHSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|