C10H16N4OS2 — CID 125140786
1-[(3S)-hex-5-en-3-yl]-3-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 125140786) has the molecular formula C10H16N4OS2 and a molecular weight of 272.40 g/mol. Its IUPAC name is 1-[(3S)-hex-5-en-3-yl]-3-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[(3S)-hex-5-en-3-yl]-3-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 125140786 |
| Molecular Formula | C10H16N4OS2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[(3S)-hex-5-en-3-yl]-3-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | C=CC[C@H](CC)NC(=O)Nc1nc(SC)ns1 |
| InChI | InChI=1S/C10H16N4OS2/c1-4-6-7(5-2)11-8(15)12-9-13-10(16-3)14-17-9/h4,7H,1,5-6H2,2-3H3,(H2,11,12,13,14,15)/t7-/m0/s1 |
| InChIKey | AZFKVIRXTOXBET-ZETCQYMHSA-N |
| XLogP | 2.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|