C15H26N2O2S2 — CID 111438387
1-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea (PubChem CID 111438387) has the molecular formula C15H26N2O2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea.
| Compound Name | 1-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
|---|---|
| PubChem CID | 111438387 |
| Molecular Formula | C15H26N2O2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
| SMILES | CSCC(C)(O)CNC(=O)NC(CC(C)C)c1cccs1 |
| InChI | InChI=1S/C15H26N2O2S2/c1-11(2)8-12(13-6-5-7-21-13)17-14(18)16-9-15(3,19)10-20-4/h5-7,11-12,19H,8-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | UIEVSNNDIFOCQG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |