C19H26N2O3S2 — CID 86826124
1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methyl-1-thiophen-2-ylbutyl)urea (PubChem CID 86826124) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methyl-1-thiophen-2-ylbutyl)urea.
| Compound Name | 1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
|---|---|
| PubChem CID | 86826124 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
| SMILES | CC(C)CC(NC(=O)NCc1ccc(CS(C)(=O)=O)cc1)c1cccs1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-14(2)11-17(18-5-4-10-25-18)21-19(22)20-12-15-6-8-16(9-7-15)13-26(3,23)24/h4-10,14,17H,11-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | PTEKOVNYKSIKKH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |