C25H19N5O2 — CID 11144289
(2E)-2-(4,5-diamino-6-cyano-7-phenylnaphthalen-2-yl)-2-(phenylhydrazinylidene)acetic acid (PubChem CID 11144289) has the molecular formula C25H19N5O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (2E)-2-(4,5-diamino-6-cyano-7-phenylnaphthalen-2-yl)-2-(phenylhydrazinylidene)acetic acid.
| Compound Name | (2E)-2-(4,5-diamino-6-cyano-7-phenylnaphthalen-2-yl)-2-(phenylhydrazinylidene)acetic acid |
|---|---|
| PubChem CID | 11144289 |
| Molecular Formula | C25H19N5O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (2E)-2-(4,5-diamino-6-cyano-7-phenylnaphthalen-2-yl)-2-(phenylhydrazinylidene)acetic acid |
| SMILES | N#Cc1c(-c2ccccc2)cc2cc(/C(=N\Nc3ccccc3)C(=O)O)cc(N)c2c1N |
| InChI | InChI=1S/C25H19N5O2/c26-14-20-19(15-7-3-1-4-8-15)12-16-11-17(13-21(27)22(16)23(20)28)24(25(31)32)30-29-18-9-5-2-6-10-18/h1-13,29H,27-28H2,(H,31,32)/b30-24+ |
| InChIKey | NTXFGLVLQQMNEE-BGABXYSRSA-N |
| XLogP | 4.44 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|