C21H40O5Si2 — CID 11144433
ethyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 11144433) has the molecular formula C21H40O5Si2 and a molecular weight of 428.72 g/mol. Its IUPAC name is ethyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 11144433 |
| Molecular Formula | C21H40O5Si2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | ethyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O5Si2/c1-12-23-19(22)14-13-15-17(24-15)18(26-28(10,11)21(5,6)7)16(14)25-27(8,9)20(2,3)4/h13,15-18H,12H2,1-11H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | OZFHZFPMXBOHFJ-MHORFTMASA-N |
| XLogP | 5.04 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|