C25H46O5Si — CID 11144894
methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylidenehept-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 11144894) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylidenehept-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylidenehept-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 11144894 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylidenehept-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=C(C/C=C/[C@]1(C(=O)OC)OC(C)(C)O[C@@H]1[C@@H](C)CC)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O5Si/c1-12-20(3)21-25(22(26)27-9,30-24(7,8)29-21)17-13-15-19(2)16-14-18-28-31(10,11)23(4,5)6/h13,17,20-21H,2,12,14-16,18H2,1,3-11H3/b17-13+/t20-,21+,25-/m0/s1 |
| InChIKey | XOENKWRLYRVAOI-NTHUKFGYSA-N |
| XLogP | 6.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|