C15H19N3O3S2 — CID 1114509
ethyl 4-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazine-1-carboxylate (PubChem CID 1114509) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1114509 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | ethyl 4-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)NC(=O)/C=C/c2cccs2)CC1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-2-21-15(20)18-9-7-17(8-10-18)14(22)16-13(19)6-5-12-4-3-11-23-12/h3-6,11H,2,7-10H2,1H3,(H,16,19,22)/b6-5+ |
| InChIKey | RBYNAKKKNJXCBW-AATRIKPKSA-N |
| XLogP | 1.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|