C14H16Cl3N3O2S2 — CID 54591741
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]prop-2-enamide (PubChem CID 54591741) has the molecular formula C14H16Cl3N3O2S2 and a molecular weight of 428.79 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591741 |
| Molecular Formula | C14H16Cl3N3O2S2 |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(NC(=S)N1CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H16Cl3N3O2S2/c15-14(16,17)12(19-13(23)20-5-7-22-8-6-20)18-11(21)4-3-10-2-1-9-24-10/h1-4,9,12H,5-8H2,(H,18,21)(H,19,23)/b4-3+ |
| InChIKey | HPVQPVZBAGIBAW-ONEGZZNKSA-N |
| XLogP | 2.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|