C13H16Cl3N3OS2 — CID 54591667
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(propan-2-ylcarbamothioylamino)ethyl]prop-2-enamide (PubChem CID 54591667) has the molecular formula C13H16Cl3N3OS2 and a molecular weight of 400.78 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(propan-2-ylcarbamothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(propan-2-ylcarbamothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591667 |
| Molecular Formula | C13H16Cl3N3OS2 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(propan-2-ylcarbamothioylamino)ethyl]prop-2-enamide |
| SMILES | CC(C)NC(=S)NC(NC(=O)/C=C/c1cccs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3N3OS2/c1-8(2)17-12(21)19-11(13(14,15)16)18-10(20)6-5-9-4-3-7-22-9/h3-8,11H,1-2H3,(H,18,20)(H2,17,19,21)/b6-5+ |
| InChIKey | QPYJRXCGYBDYTI-AATRIKPKSA-N |
| XLogP | 3.45 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|