C28H45NO7Si — CID 11145915
(4S)-4-benzyl-3-[(2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 11145915) has the molecular formula C28H45NO7Si and a molecular weight of 535.75 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11145915 |
| Molecular Formula | C28H45NO7Si |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]([C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H45NO7Si/c1-18(24(22-17-34-28(6,7)35-22)36-37(8,9)27(3,4)5)23(30)19(2)25(31)29-21(16-33-26(29)32)15-20-13-11-10-12-14-20/h10-14,18-19,21-24,30H,15-17H2,1-9H3/t18-,19+,21+,22+,23-,24+/m1/s1 |
| InChIKey | WSPFMQVEHWAJCF-YNFNHKPXSA-N |
| XLogP | 4.75 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|