C27H39NO7 — CID 25208331
(4R)-4-benzyl-3-[(2R,3S)-4-[(4S,6S)-2,2-dimethyl-6-[(1R,2R)-2-methylcyclopropyl]-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2-methylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 25208331) has the molecular formula C27H39NO7 and a molecular weight of 489.61 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-4-[(4S,6S)-2,2-dimethyl-6-[(1R,2R)-2-methylcyclopropyl]-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2-methylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-4-[(4S,6S)-2,2-dimethyl-6-[(1R,2R)-2-methylcyclopropyl]-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2-methylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25208331 |
| Molecular Formula | C27H39NO7 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-4-[(4S,6S)-2,2-dimethyl-6-[(1R,2R)-2-methylcyclopropyl]-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2-methylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | COCO[C@@H](C[C@H]1C[C@@H]([C@@H]2C[C@H]2C)OC(C)(C)O1)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H39NO7/c1-17-11-22(17)24-14-21(34-27(3,4)35-24)13-23(33-16-31-5)18(2)25(29)28-20(15-32-26(28)30)12-19-9-7-6-8-10-19/h6-10,17-18,20-24H,11-16H2,1-5H3/t17-,18-,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | PGGCRHAXFDAOHX-UZOKTTEXSA-N |
| XLogP | 4.16 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|