C26H41NO5Si — CID 139191189
(4R)-4-benzyl-3-[(2R,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methyloct-7-enoyl]-1,3-oxazolidin-2-one (PubChem CID 139191189) has the molecular formula C26H41NO5Si and a molecular weight of 475.70 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methyloct-7-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methyloct-7-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139191189 |
| Molecular Formula | C26H41NO5Si |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2-methyloct-7-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C[C@H](OC)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H41NO5Si/c1-9-13-22(32-33(7,8)26(3,4)5)17-23(30-6)19(2)24(28)27-21(18-31-25(27)29)16-20-14-11-10-12-15-20/h9-12,14-15,19,21-23H,1,13,16-18H2,2-8H3/t19-,21-,22-,23+/m1/s1 |
| InChIKey | VKGCUXGODRQTIR-ADHNFCLRSA-N |
| XLogP | 5.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|