C33H55NO7Si — CID 134863669
(4S)-4-benzyl-3-[(2S,3R,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,8-trimethyl-7-(oxan-2-yloxy)nonanoyl]-1,3-oxazolidin-2-one (PubChem CID 134863669) has the molecular formula C33H55NO7Si and a molecular weight of 605.89 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,8-trimethyl-7-(oxan-2-yloxy)nonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,8-trimethyl-7-(oxan-2-yloxy)nonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134863669 |
| Molecular Formula | C33H55NO7Si |
| Molecular Weight | 605.89 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,8-trimethyl-7-(oxan-2-yloxy)nonanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)CC[C@H](C)[C@H](OC1CCCCO1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H55NO7Si/c1-23(30(41-29-16-12-13-19-38-29)24(2)21-40-42(7,8)33(4,5)6)17-18-28(35)25(3)31(36)34-27(22-39-32(34)37)20-26-14-10-9-11-15-26/h9-11,14-15,23-25,27-30,35H,12-13,16-22H2,1-8H3/t23-,24-,25-,27-,28+,29?,30-/m0/s1 |
| InChIKey | BMNZXEFMBDTVTN-YEOSLXFHSA-N |
| XLogP | 6.56 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.89 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|