C34H61NO7Si2 — CID 54578142
(4R)-4-benzyl-3-[(2R,3S,5R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one (PubChem CID 54578142) has the molecular formula C34H61NO7Si2 and a molecular weight of 652.03 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54578142 |
| Molecular Formula | C34H61NO7Si2 |
| Molecular Weight | 652.03 g/mol |
| Exact Mass | 651.40 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C34H61NO7Si2/c1-12-44(13-2,14-3)42-30(34(8,39-9)21-18-22-41-43(10,11)33(5,6)7)24-29(36)26(4)31(37)35-28(25-40-32(35)38)23-27-19-16-15-17-20-27/h15-17,19-20,26,28-30,36H,12-14,18,21-25H2,1-11H3/t26-,28-,29+,30-,34-/m1/s1 |
| InChIKey | CJOHPLHSROPSAN-AWVJDWFHSA-N |
| XLogP | 7.56 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.03 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|