C34H42N2O7 — CID 11146361
prop-2-enyl N-[2-(hydroxymethyl)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 11146361) has the molecular formula C34H42N2O7 and a molecular weight of 590.72 g/mol. Its IUPAC name is prop-2-enyl N-[2-(hydroxymethyl)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[2-(hydroxymethyl)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 11146361 |
| Molecular Formula | C34H42N2O7 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | prop-2-enyl N-[2-(hydroxymethyl)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | C=CCOC(=O)NCC(CO)(CNC(=O)OC(C)(C)C)COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H42N2O7/c1-6-21-41-30(38)35-22-33(24-37,23-36-31(39)43-32(2,3)4)25-42-34(26-13-9-7-10-14-26,27-15-11-8-12-16-27)28-17-19-29(40-5)20-18-28/h6-20,37H,1,21-25H2,2-5H3,(H,35,38)(H,36,39) |
| InChIKey | YYRLWKWGGRYUTH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|