C22H29N3O7 — CID 11048583
prop-2-enyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2-(hydroxymethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 11048583) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2-(hydroxymethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2-(hydroxymethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 11048583 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | prop-2-enyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2-(hydroxymethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | C=CCOC(=O)NCC(CO)(CNC(=O)OC(C)(C)C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H29N3O7/c1-5-10-31-19(29)23-11-22(14-26,12-24-20(30)32-21(2,3)4)13-25-17(27)15-8-6-7-9-16(15)18(25)28/h5-9,26H,1,10-14H2,2-4H3,(H,23,29)(H,24,30) |
| InChIKey | MPVUCNPWDUNQDI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|