C21H33N5 — CID 111464850
1-butyl-3-[4-(2-methylimidazol-1-yl)butyl]-2-[(4-methylphenyl)methyl]guanidine (PubChem CID 111464850) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-butyl-3-[4-(2-methylimidazol-1-yl)butyl]-2-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 1-butyl-3-[4-(2-methylimidazol-1-yl)butyl]-2-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111464850 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 1-butyl-3-[4-(2-methylimidazol-1-yl)butyl]-2-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1ccc(C)cc1)NCCCCn1ccnc1C |
| InChI | InChI=1S/C21H33N5/c1-4-5-12-23-21(25-17-20-10-8-18(2)9-11-20)24-13-6-7-15-26-16-14-22-19(26)3/h8-11,14,16H,4-7,12-13,15,17H2,1-3H3,(H2,23,24,25) |
| InChIKey | OOSWVKAPDISPQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|