C13H18N6 — CID 111465978
1-cyclopropyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111465978) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111465978 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-cyclopropyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | N/C(=N\CCCc1nnc2ccccn12)NC1CC1 |
| InChI | InChI=1S/C13H18N6/c14-13(16-10-6-7-10)15-8-3-5-12-18-17-11-4-1-2-9-19(11)12/h1-2,4,9-10H,3,5-8H2,(H3,14,15,16) |
| InChIKey | PCUVYFXTGUSSLX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|