C17H24N2OS — CID 111468879
[1-methyl-2-[[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methylamino]cyclopentyl]methanol (PubChem CID 111468879) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is [1-methyl-2-[[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methylamino]cyclopentyl]methanol.
| Compound Name | [1-methyl-2-[[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 111468879 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [1-methyl-2-[[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methylamino]cyclopentyl]methanol |
| SMILES | CC1(CO)CCCC1NCc1cccn1Cc1cccs1 |
| InChI | InChI=1S/C17H24N2OS/c1-17(13-20)8-2-7-16(17)18-11-14-5-3-9-19(14)12-15-6-4-10-21-15/h3-6,9-10,16,18,20H,2,7-8,11-13H2,1H3 |
| InChIKey | DWWIVIWQVAGFRU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |