C15H19N3O3S — CID 111469051
3-methyl-3-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methylamino]butan-1-ol (PubChem CID 111469051) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-methyl-3-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methylamino]butan-1-ol.
| Compound Name | 3-methyl-3-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 111469051 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-methyl-3-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methylamino]butan-1-ol |
| SMILES | CC(C)(CCO)NCc1csc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H19N3O3S/c1-15(2,6-7-19)16-9-12-10-22-14(17-12)11-4-3-5-13(8-11)18(20)21/h3-5,8,10,16,19H,6-7,9H2,1-2H3 |
| InChIKey | IZVPGHMAPZVTCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|