C15H18ClNO2S2 — CID 111469636
1-(5-chlorothiophen-2-yl)-2-[(4-methoxy-3-methylsulfanylphenyl)methylamino]ethanol (PubChem CID 111469636) has the molecular formula C15H18ClNO2S2 and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-[(4-methoxy-3-methylsulfanylphenyl)methylamino]ethanol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-[(4-methoxy-3-methylsulfanylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 111469636 |
| Molecular Formula | C15H18ClNO2S2 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-[(4-methoxy-3-methylsulfanylphenyl)methylamino]ethanol |
| SMILES | COc1ccc(CNCC(O)c2ccc(Cl)s2)cc1SC |
| InChI | InChI=1S/C15H18ClNO2S2/c1-19-12-4-3-10(7-14(12)20-2)8-17-9-11(18)13-5-6-15(16)21-13/h3-7,11,17-18H,8-9H2,1-2H3 |
| InChIKey | DTIUKIMYTYJHOP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |