C19H22O3S — CID 111472416
1-(3,5-dimethylphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfonylethanol (PubChem CID 111472416) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfonylethanol.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfonylethanol |
|---|---|
| PubChem CID | 111472416 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfonylethanol |
| SMILES | Cc1cc(C)cc(C(O)CS(=O)(=O)C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C19H22O3S/c1-15-11-16(2)13-18(12-15)19(20)14-23(21,22)10-6-9-17-7-4-3-5-8-17/h3-9,11-13,19-20H,10,14H2,1-2H3/b9-6+ |
| InChIKey | YSHGMUHERZOXRI-RMKNXTFCSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |