About 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea
1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111478766) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
Molecular Properties
| Compound Name | 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| PubChem CID | 111478766 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nn1cnc2ccccc21 |
| InChI | InChI=1S/C15H22N4O2/c1-11(20)8-15(2,3)9-16-14(21)18-19-10-17-12-6-4-5-7-13(12)19/h4-7,10-11,20H,8-9H2,1-3H3,(H2,16,18,21) |
| InChIKey | QTMFMPGPRVPBRY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea?
The IUPAC name of 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (CID 111478766) is 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
What is the SMILES notation for 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea?
The canonical SMILES for 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea is CC(O)CC(C)(C)CNC(=O)Nn1cnc2ccccc21.
What is the InChIKey of 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea?
The InChIKey is QTMFMPGPRVPBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-11(20)8-15(2,3)9-16-14(21)18-19-10-17-12-6-4-5-7-13(12)19/h4-7,10-11,20H,8-9H2,1-3H3,(H2,16,18,21).
What are the key properties of 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea?
1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea has a molecular weight of 290.37 g/mol, XLogP of 2.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzimidazol-1-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea is sourced from PubChem (CID 111478766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).