C13H24O2Si — CID 11149166
[(E)-3-[(1S,4S)-4-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane (PubChem CID 11149166) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is [(E)-3-[(1S,4S)-4-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane.
| Compound Name | [(E)-3-[(1S,4S)-4-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11149166 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(E)-3-[(1S,4S)-4-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane |
| SMILES | COCO[C@@H]1C=C[C@@H](C/C=C/[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H24O2Si/c1-14-11-15-13-8-7-12(10-13)6-5-9-16(2,3)4/h5,7-9,12-13H,6,10-11H2,1-4H3/b9-5+/t12-,13-/m1/s1 |
| InChIKey | YNZXHHTXKKZIPU-UDHZEARHSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|