C13H23F3N4O — CID 111493202
2-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111493202) has the molecular formula C13H23F3N4O and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111493202 |
| Molecular Formula | C13H23F3N4O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C13H23F3N4O/c1-17-12(19-10-6-4-3-5-7-10)18-8-11(21)20(2)9-13(14,15)16/h10H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | NWWUIBILQUOWHH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|