C20H31N7 — CID 111494204
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylcyclohexyl)-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 111494204) has the molecular formula C20H31N7 and a molecular weight of 369.52 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylcyclohexyl)-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylcyclohexyl)-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111494204 |
| Molecular Formula | C20H31N7 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylcyclohexyl)-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccccn1)NC1CCCCC1C |
| InChI | InChI=1S/C20H31N7/c1-3-19-26-24-15-27(19)13-12-22-20(23-14-17-9-6-7-11-21-17)25-18-10-5-4-8-16(18)2/h6-7,9,11,15-16,18H,3-5,8,10,12-14H2,1-2H3,(H2,22,23,25) |
| InChIKey | CPLAMEGTVJSORY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|