About 2-nitroindolo[1,2-b]indazol-11-one
2-nitroindolo[1,2-b]indazol-11-one (PubChem CID 11149757) has the molecular formula C14H7N3O3
and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-nitroindolo[1,2-b]indazol-11-one.
Molecular Properties
| Compound Name | 2-nitroindolo[1,2-b]indazol-11-one |
| PubChem CID | 11149757 |
| Molecular Formula | C14H7N3O3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-nitroindolo[1,2-b]indazol-11-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-n2nc3ccccc3c21 |
| InChI | InChI=1S/C14H7N3O3/c18-14-10-7-8(17(19)20)5-6-12(10)16-13(14)9-3-1-2-4-11(9)15-16/h1-7H |
| InChIKey | OSIFAGKNSNQNAG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroindolo[1,2-b]indazol-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroindolo[1,2-b]indazol-11-one?
The IUPAC name of 2-nitroindolo[1,2-b]indazol-11-one (CID 11149757) is 2-nitroindolo[1,2-b]indazol-11-one.
What is the SMILES notation for 2-nitroindolo[1,2-b]indazol-11-one?
The canonical SMILES for 2-nitroindolo[1,2-b]indazol-11-one is O=C1c2cc([N+](=O)[O-])ccc2-n2nc3ccccc3c21.
What is the InChIKey of 2-nitroindolo[1,2-b]indazol-11-one?
The InChIKey is OSIFAGKNSNQNAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7N3O3/c18-14-10-7-8(17(19)20)5-6-12(10)16-13(14)9-3-1-2-4-11(9)15-16/h1-7H.
What are the key properties of 2-nitroindolo[1,2-b]indazol-11-one?
2-nitroindolo[1,2-b]indazol-11-one has a molecular weight of 265.23 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroindolo[1,2-b]indazol-11-one is sourced from PubChem (CID 11149757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).