C15H26N4O2 — CID 111505787
1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 111505787) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 111505787 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[2-(hydroxymethyl)-2-methylcyclopentyl]-3-[3-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | Cn1cc(CCCNC(=O)NC2CCCC2(C)CO)cn1 |
| InChI | InChI=1S/C15H26N4O2/c1-15(11-20)7-3-6-13(15)18-14(21)16-8-4-5-12-9-17-19(2)10-12/h9-10,13,20H,3-8,11H2,1-2H3,(H2,16,18,21) |
| InChIKey | RDPZHFWAXLHULE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|