C14H20F3N5O2 — CID 96524449
1-[3-(1-methylpyrazol-4-yl)propyl]-3-[(3S)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea (PubChem CID 96524449) has the molecular formula C14H20F3N5O2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 1-[3-(1-methylpyrazol-4-yl)propyl]-3-[(3S)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-[3-(1-methylpyrazol-4-yl)propyl]-3-[(3S)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 96524449 |
| Molecular Formula | C14H20F3N5O2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[3-(1-methylpyrazol-4-yl)propyl]-3-[(3S)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
| SMILES | Cn1cc(CCCNC(=O)N[C@H]2CCN(CC(F)(F)F)C2=O)cn1 |
| InChI | InChI=1S/C14H20F3N5O2/c1-21-8-10(7-19-21)3-2-5-18-13(24)20-11-4-6-22(12(11)23)9-14(15,16)17/h7-8,11H,2-6,9H2,1H3,(H2,18,20,24)/t11-/m0/s1 |
| InChIKey | CXRXSYLVGPHSOF-NSHDSACASA-N |
| XLogP | 0.82 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|