C12H26N2O3 — CID 111508605
1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-methoxy-2-methylpropyl)urea (PubChem CID 111508605) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-methoxy-2-methylpropyl)urea.
| Compound Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-methoxy-2-methylpropyl)urea |
|---|---|
| PubChem CID | 111508605 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-methoxy-2-methylpropyl)urea |
| SMILES | COC(C)(C)CNC(=O)NC(CCO)C(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-9(2)10(6-7-15)14-11(16)13-8-12(3,4)17-5/h9-10,15H,6-8H2,1-5H3,(H2,13,14,16) |
| InChIKey | FZUHXQVHXBALRK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |