C18H16N2O2S — CID 11151488
3-[2-(dimethylamino)ethyl]-11-thia-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione (PubChem CID 11151488) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-11-thia-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-11-thia-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 11151488 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-11-thia-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2ccsc23)C1=O |
| InChI | InChI=1S/C18H16N2O2S/c1-19(2)7-8-20-17(21)13-5-3-4-12-15(13)14(18(20)22)10-11-6-9-23-16(11)12/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | WFDNFFJNMQSHOJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|